C17H23NO4S — CID 138959128
1-(2,6-dimethoxyphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol (PubChem CID 138959128) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol.
| Compound Name | 1-(2,6-dimethoxyphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 138959128 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-(2,6-dimethoxyphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol |
| SMILES | COc1cccc(OC)c1OCC(O)CNC(C)c1cccs1 |
| InChI | InChI=1S/C17H23NO4S/c1-12(16-8-5-9-23-16)18-10-13(19)11-22-17-14(20-2)6-4-7-15(17)21-3/h4-9,12-13,18-19H,10-11H2,1-3H3 |
| InChIKey | DNGOTSPAUZDELU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |