C19H28ClNO2S — CID 138959141
1-(2-butan-2-ylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride (PubChem CID 138959141) has the molecular formula C19H28ClNO2S and a molecular weight of 369.96 g/mol. Its IUPAC name is 1-(2-butan-2-ylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(2-butan-2-ylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959141 |
| Molecular Formula | C19H28ClNO2S |
| Molecular Weight | 369.96 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-(2-butan-2-ylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
| SMILES | CCC(C)c1ccccc1OCC(O)CNC(C)c1cccs1.Cl |
| InChI | InChI=1S/C19H27NO2S.ClH/c1-4-14(2)17-8-5-6-9-18(17)22-13-16(21)12-20-15(3)19-10-7-11-23-19;/h5-11,14-16,20-21H,4,12-13H2,1-3H3;1H |
| InChIKey | SQFAJXFYWUEOBK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.96 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |