C15H18BrNO2S — CID 81408393
1-(4-bromophenoxy)-3-[[(1R)-1-thiophen-2-ylethyl]amino]propan-2-ol (PubChem CID 81408393) has the molecular formula C15H18BrNO2S and a molecular weight of 356.29 g/mol. Its IUPAC name is 1-(4-bromophenoxy)-3-[[(1R)-1-thiophen-2-ylethyl]amino]propan-2-ol.
| Compound Name | 1-(4-bromophenoxy)-3-[[(1R)-1-thiophen-2-ylethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 81408393 |
| Molecular Formula | C15H18BrNO2S |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 1-(4-bromophenoxy)-3-[[(1R)-1-thiophen-2-ylethyl]amino]propan-2-ol |
| SMILES | C[C@@H](NCC(O)COc1ccc(Br)cc1)c1cccs1 |
| InChI | InChI=1S/C15H18BrNO2S/c1-11(15-3-2-8-20-15)17-9-13(18)10-19-14-6-4-12(16)5-7-14/h2-8,11,13,17-18H,9-10H2,1H3/t11-,13?/m1/s1 |
| InChIKey | GPABXSIYBFXWIQ-JTDNENJMSA-N |
| XLogP | 3.60 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |