C14H12F2O4S3 — CID 51285177
4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-difluorobenzene (PubChem CID 51285177) has the molecular formula C14H12F2O4S3 and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-difluorobenzene.
| Compound Name | 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-difluorobenzene |
|---|---|
| PubChem CID | 51285177 |
| Molecular Formula | C14H12F2O4S3 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-difluorobenzene |
| SMILES | CS(=O)(=O)c1ccc(Sc2ccc(F)c(F)c2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H12F2O4S3/c1-22(17,18)10-4-6-13(14(8-10)23(2,19)20)21-9-3-5-11(15)12(16)7-9/h3-8H,1-2H3 |
| InChIKey | HMOPNIQLISOZOM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |