About 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene
2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene (PubChem CID 95040843) has the molecular formula C16H16F2O4S3
and a molecular weight of 406.50 g/mol. Its IUPAC name is 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene.
Molecular Properties
| Compound Name | 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene |
| PubChem CID | 95040843 |
| Molecular Formula | C16H16F2O4S3 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene |
| SMILES | C[C@@H](Sc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H16F2O4S3/c1-10(16-12(17)5-4-6-13(16)18)23-14-8-7-11(24(2,19)20)9-15(14)25(3,21)22/h4-10H,1-3H3/t10-/m1/s1 |
| InChIKey | LKRZZOALLBGPRF-SNVBAGLBSA-N |
| XLogP | 3.63 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene?
The IUPAC name of 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene (CID 95040843) is 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene.
What is the SMILES notation for 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene?
The canonical SMILES for 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene is C[C@@H](Sc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O)c1c(F)cccc1F.
What is the InChIKey of 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene?
The InChIKey is LKRZZOALLBGPRF-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H16F2O4S3/c1-10(16-12(17)5-4-6-13(16)18)23-14-8-7-11(24(2,19)20)9-15(14)25(3,21)22/h4-10H,1-3H3/t10-/m1/s1.
What are the key properties of 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene?
2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene has a molecular weight of 406.50 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-1-[2,4-bis(methylsulfonyl)phenyl]sulfanylethyl]-1,3-difluorobenzene is sourced from PubChem (CID 95040843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).