C16H17ClFNO4S2 — CID 133356473
N-[1-(2-chloro-6-fluorophenyl)ethyl]-2,4-bis(methylsulfonyl)aniline (PubChem CID 133356473) has the molecular formula C16H17ClFNO4S2 and a molecular weight of 405.90 g/mol. Its IUPAC name is N-[1-(2-chloro-6-fluorophenyl)ethyl]-2,4-bis(methylsulfonyl)aniline.
| Compound Name | N-[1-(2-chloro-6-fluorophenyl)ethyl]-2,4-bis(methylsulfonyl)aniline |
|---|---|
| PubChem CID | 133356473 |
| Molecular Formula | C16H17ClFNO4S2 |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | N-[1-(2-chloro-6-fluorophenyl)ethyl]-2,4-bis(methylsulfonyl)aniline |
| SMILES | CC(Nc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H17ClFNO4S2/c1-10(16-12(17)5-4-6-13(16)18)19-14-8-7-11(24(2,20)21)9-15(14)25(3,22)23/h4-10,19H,1-3H3 |
| InChIKey | MQLOOHXNOUQETL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |