C14H11BrFNO3 — CID 70151029
7-(1-bromocyclopropyl)-6-fluoro-5-methyl-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 70151029) has the molecular formula C14H11BrFNO3 and a molecular weight of 340.15 g/mol. Its IUPAC name is 7-(1-bromocyclopropyl)-6-fluoro-5-methyl-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 7-(1-bromocyclopropyl)-6-fluoro-5-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 70151029 |
| Molecular Formula | C14H11BrFNO3 |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 7-(1-bromocyclopropyl)-6-fluoro-5-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | Cc1c(F)c(C2(Br)CC2)cc2[nH]cc(C(=O)O)c(=O)c12 |
| InChI | InChI=1S/C14H11BrFNO3/c1-6-10-9(17-5-7(12(10)18)13(19)20)4-8(11(6)16)14(15)2-3-14/h4-5H,2-3H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | MHGHPBIXNXRUSR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|