C18H12F3NO4 — CID 162518072
4-oxo-6-[[4-(trifluoromethyl)phenyl]methoxy]-1H-quinoline-3-carboxylic acid (PubChem CID 162518072) has the molecular formula C18H12F3NO4 and a molecular weight of 363.29 g/mol. Its IUPAC name is 4-oxo-6-[[4-(trifluoromethyl)phenyl]methoxy]-1H-quinoline-3-carboxylic acid.
| Compound Name | 4-oxo-6-[[4-(trifluoromethyl)phenyl]methoxy]-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 162518072 |
| Molecular Formula | C18H12F3NO4 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-oxo-6-[[4-(trifluoromethyl)phenyl]methoxy]-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2ccc(OCc3ccc(C(F)(F)F)cc3)cc2c1=O |
| InChI | InChI=1S/C18H12F3NO4/c19-18(20,21)11-3-1-10(2-4-11)9-26-12-5-6-15-13(7-12)16(23)14(8-22-15)17(24)25/h1-8H,9H2,(H,22,23)(H,24,25) |
| InChIKey | PSNGPKWLEASFPN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |