C26H23NO7 — CID 118451648
6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 118451648) has the molecular formula C26H23NO7 and a molecular weight of 461.47 g/mol. Its IUPAC name is 6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 118451648 |
| Molecular Formula | C26H23NO7 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | COc1ccc(COc2cc3[nH]cc(C(=O)O)c(=O)c3cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H23NO7/c1-31-18-7-3-16(4-8-18)14-33-23-11-20-22(27-13-21(25(20)28)26(29)30)12-24(23)34-15-17-5-9-19(32-2)10-6-17/h3-13H,14-15H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | XVXKZUVVOMWECY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |