C25H24N2O6 — CID 141366567
3-(hydroxymethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-1H-cinnolin-4-one (PubChem CID 141366567) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 3-(hydroxymethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-1H-cinnolin-4-one.
| Compound Name | 3-(hydroxymethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-1H-cinnolin-4-one |
|---|---|
| PubChem CID | 141366567 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-(hydroxymethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-1H-cinnolin-4-one |
| SMILES | COc1ccc(COc2cc3[nH]nc(CO)c(=O)c3cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O6/c1-30-18-7-3-16(4-8-18)14-32-23-11-20-21(26-27-22(13-28)25(20)29)12-24(23)33-15-17-5-9-19(31-2)10-6-17/h3-12,28H,13-15H2,1-2H3,(H,26,29) |
| InChIKey | CUAXBCISDVOPND-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |