C18H22N2O5 — CID 134575688
6-(2-hydroxyethyl)-3-methoxy-4-[(4-methoxyphenyl)methoxy]-N-methylpyridine-2-carboxamide (PubChem CID 134575688) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-3-methoxy-4-[(4-methoxyphenyl)methoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-(2-hydroxyethyl)-3-methoxy-4-[(4-methoxyphenyl)methoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 134575688 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 6-(2-hydroxyethyl)-3-methoxy-4-[(4-methoxyphenyl)methoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1nc(CCO)cc(OCc2ccc(OC)cc2)c1OC |
| InChI | InChI=1S/C18H22N2O5/c1-19-18(22)16-17(24-3)15(10-13(20-16)8-9-21)25-11-12-4-6-14(23-2)7-5-12/h4-7,10,21H,8-9,11H2,1-3H3,(H,19,22) |
| InChIKey | QXPYXEDGXKTQJE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |