C22H21FN2O5 — CID 66675011
[2-tert-butyl-4-fluoro-6-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl] methyl carbonate (PubChem CID 66675011) has the molecular formula C22H21FN2O5 and a molecular weight of 412.42 g/mol. Its IUPAC name is [2-tert-butyl-4-fluoro-6-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl] methyl carbonate.
| Compound Name | [2-tert-butyl-4-fluoro-6-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 66675011 |
| Molecular Formula | C22H21FN2O5 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [2-tert-butyl-4-fluoro-6-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1c(NC(=O)c2c[nH]c3ccccc3c2=O)cc(F)cc1C(C)(C)C |
| InChI | InChI=1S/C22H21FN2O5/c1-22(2,3)15-9-12(23)10-17(19(15)30-21(28)29-4)25-20(27)14-11-24-16-8-6-5-7-13(16)18(14)26/h5-11H,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | TXGBGRBVVGUWRC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|