C31H40N2O9 — CID 167163845
N-[2-tert-butyl-5-hydroxy-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 167163845) has the molecular formula C31H40N2O9 and a molecular weight of 584.67 g/mol. Its IUPAC name is N-[2-tert-butyl-5-hydroxy-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-tert-butyl-5-hydroxy-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 167163845 |
| Molecular Formula | C31H40N2O9 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | N-[2-tert-butyl-5-hydroxy-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CC(C)(C)c1cc(OCCOCCOCCOCCOCCC=O)c(O)cc1NC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C31H40N2O9/c1-31(2,3)24-19-28(42-18-17-41-16-15-40-14-13-39-12-11-38-10-6-9-34)27(35)20-26(24)33-30(37)23-21-32-25-8-5-4-7-22(25)29(23)36/h4-5,7-9,19-21,35H,6,10-18H2,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | MUGUYOMDARTJQN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|