C23H23FN2O3 — CID 87101825
N-[2-fluoro-5-hydroxy-4-(1-methylcyclohexyl)phenyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 87101825) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[2-fluoro-5-hydroxy-4-(1-methylcyclohexyl)phenyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-fluoro-5-hydroxy-4-(1-methylcyclohexyl)phenyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 87101825 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[2-fluoro-5-hydroxy-4-(1-methylcyclohexyl)phenyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CC1(c2cc(F)c(NC(=O)c3c[nH]c4ccccc4c3=O)cc2O)CCCCC1 |
| InChI | InChI=1S/C23H23FN2O3/c1-23(9-5-2-6-10-23)16-11-17(24)19(12-20(16)27)26-22(29)15-13-25-18-8-4-3-7-14(18)21(15)28/h3-4,7-8,11-13,27H,2,5-6,9-10H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | VOARPNGQFYFFOR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |