C17H13F2N3O3 — CID 31977116
N'-[2-(2,4-difluorophenoxy)acetyl]-1H-indole-3-carbohydrazide (PubChem CID 31977116) has the molecular formula C17H13F2N3O3 and a molecular weight of 345.31 g/mol. Its IUPAC name is N'-[2-(2,4-difluorophenoxy)acetyl]-1H-indole-3-carbohydrazide.
| Compound Name | N'-[2-(2,4-difluorophenoxy)acetyl]-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 31977116 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N'-[2-(2,4-difluorophenoxy)acetyl]-1H-indole-3-carbohydrazide |
| SMILES | O=C(COc1ccc(F)cc1F)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H13F2N3O3/c18-10-5-6-15(13(19)7-10)25-9-16(23)21-22-17(24)12-8-20-14-4-2-1-3-11(12)14/h1-8,20H,9H2,(H,21,23)(H,22,24) |
| InChIKey | KBJVSOCDVMZWMC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|