C14H18N4OS2 — CID 7978198
1-[3-(1,3-benzothiazol-2-yl)propanoylamino]-3-propan-2-ylthiourea (PubChem CID 7978198) has the molecular formula C14H18N4OS2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)propanoylamino]-3-propan-2-ylthiourea.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)propanoylamino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 7978198 |
| Molecular Formula | C14H18N4OS2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)propanoylamino]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NNC(=O)CCc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H18N4OS2/c1-9(2)15-14(20)18-17-12(19)7-8-13-16-10-5-3-4-6-11(10)21-13/h3-6,9H,7-8H2,1-2H3,(H,17,19)(H2,15,18,20) |
| InChIKey | SNMWOIWMLSYJQQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|