C23H23N3O3S — CID 4878259
methyl 2-[4-(1,3-benzothiazol-2-yl)butanoylamino]-3-(1H-indol-3-yl)propanoate (PubChem CID 4878259) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is methyl 2-[4-(1,3-benzothiazol-2-yl)butanoylamino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[4-(1,3-benzothiazol-2-yl)butanoylamino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 4878259 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | methyl 2-[4-(1,3-benzothiazol-2-yl)butanoylamino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H23N3O3S/c1-29-23(28)19(13-15-14-24-17-8-3-2-7-16(15)17)25-21(27)11-6-12-22-26-18-9-4-5-10-20(18)30-22/h2-5,7-10,14,19,24H,6,11-13H2,1H3,(H,25,27) |
| InChIKey | GIYQNPDIORJDDR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |