C21H20N4O3S — CID 9323419
5-(1,3-benzothiazol-2-yl)-N'-[2-(4-cyanophenoxy)acetyl]pentanehydrazide (PubChem CID 9323419) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N'-[2-(4-cyanophenoxy)acetyl]pentanehydrazide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N'-[2-(4-cyanophenoxy)acetyl]pentanehydrazide |
|---|---|
| PubChem CID | 9323419 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N'-[2-(4-cyanophenoxy)acetyl]pentanehydrazide |
| SMILES | N#Cc1ccc(OCC(=O)NNC(=O)CCCCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H20N4O3S/c22-13-15-9-11-16(12-10-15)28-14-20(27)25-24-19(26)7-3-4-8-21-23-17-5-1-2-6-18(17)29-21/h1-2,5-6,9-12H,3-4,7-8,14H2,(H,24,26)(H,25,27) |
| InChIKey | FWJPHEOEBMNXKJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|