C24H31N3O2S — CID 9326327
N'-[2-(1-adamantyl)acetyl]-5-(1,3-benzothiazol-2-yl)pentanehydrazide (PubChem CID 9326327) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-5-(1,3-benzothiazol-2-yl)pentanehydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-5-(1,3-benzothiazol-2-yl)pentanehydrazide |
|---|---|
| PubChem CID | 9326327 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-5-(1,3-benzothiazol-2-yl)pentanehydrazide |
| SMILES | O=C(CCCCc1nc2ccccc2s1)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H31N3O2S/c28-21(7-3-4-8-23-25-19-5-1-2-6-20(19)30-23)26-27-22(29)15-24-12-16-9-17(13-24)11-18(10-16)14-24/h1-2,5-6,16-18H,3-4,7-15H2,(H,26,28)(H,27,29) |
| InChIKey | BMDLHJBUTCTDAB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|