C17H23N3O2S — CID 38285048
N-[4-(1,3-benzothiazol-2-ylmethylamino)-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 38285048) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-ylmethylamino)-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-ylmethylamino)-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 38285048 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-ylmethylamino)-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCC(=O)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H23N3O2S/c1-17(2,3)16(22)18-10-6-9-14(21)19-11-15-20-12-7-4-5-8-13(12)23-15/h4-5,7-8H,6,9-11H2,1-3H3,(H,18,22)(H,19,21) |
| InChIKey | RWKSLGUTCYFMQK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|