C21H24N2OS — CID 24543254
N-(1,3-benzothiazol-2-ylmethyl)-3-(4-tert-butylphenyl)propanamide (PubChem CID 24543254) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3-(4-tert-butylphenyl)propanamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3-(4-tert-butylphenyl)propanamide |
|---|---|
| PubChem CID | 24543254 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3-(4-tert-butylphenyl)propanamide |
| SMILES | CC(C)(C)c1ccc(CCC(=O)NCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H24N2OS/c1-21(2,3)16-11-8-15(9-12-16)10-13-19(24)22-14-20-23-17-6-4-5-7-18(17)25-20/h4-9,11-12H,10,13-14H2,1-3H3,(H,22,24) |
| InChIKey | QNRMFVIUZZGMBH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |