C24H29N5O5S — CID 55457895
ethyl 4-[4-[3-(benzimidazol-1-yl)propylcarbamoyl]piperazin-1-yl]sulfonylbenzoate (PubChem CID 55457895) has the molecular formula C24H29N5O5S and a molecular weight of 499.59 g/mol. Its IUPAC name is ethyl 4-[4-[3-(benzimidazol-1-yl)propylcarbamoyl]piperazin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[3-(benzimidazol-1-yl)propylcarbamoyl]piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 55457895 |
| Molecular Formula | C24H29N5O5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | ethyl 4-[4-[3-(benzimidazol-1-yl)propylcarbamoyl]piperazin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)NCCCn3cnc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C24H29N5O5S/c1-2-34-23(30)19-8-10-20(11-9-19)35(32,33)29-16-14-27(15-17-29)24(31)25-12-5-13-28-18-26-21-6-3-4-7-22(21)28/h3-4,6-11,18H,2,5,12-17H2,1H3,(H,25,31) |
| InChIKey | XEDZZRRXPWSBMA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|