C21H25N4O4S+ — CID 2426682
ethyl 4-[4-(benzimidazol-1-ylmethyl)piperazin-4-ium-1-yl]sulfonylbenzoate (PubChem CID 2426682) has the molecular formula C21H25N4O4S+ and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 4-[4-(benzimidazol-1-ylmethyl)piperazin-4-ium-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-(benzimidazol-1-ylmethyl)piperazin-4-ium-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 2426682 |
| Molecular Formula | C21H25N4O4S+ |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | ethyl 4-[4-(benzimidazol-1-ylmethyl)piperazin-4-ium-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CC[NH+](Cn3cnc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O4S/c1-2-29-21(26)17-7-9-18(10-8-17)30(27,28)25-13-11-23(12-14-25)16-24-15-22-19-5-3-4-6-20(19)24/h3-10,15H,2,11-14,16H2,1H3/p+1 |
| InChIKey | OTZPKGUDIUGFAZ-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |