C20H31N2O4S+ — CID 7420553
ethyl 4-[4-[(3R)-3-methylpiperidin-1-ium-1-yl]piperidin-1-yl]sulfonylbenzoate (PubChem CID 7420553) has the molecular formula C20H31N2O4S+ and a molecular weight of 395.55 g/mol. Its IUPAC name is ethyl 4-[4-[(3R)-3-methylpiperidin-1-ium-1-yl]piperidin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[(3R)-3-methylpiperidin-1-ium-1-yl]piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 7420553 |
| Molecular Formula | C20H31N2O4S+ |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | ethyl 4-[4-[(3R)-3-methylpiperidin-1-ium-1-yl]piperidin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC([NH+]3CCC[C@@H](C)C3)CC2)cc1 |
| InChI | InChI=1S/C20H30N2O4S/c1-3-26-20(23)17-6-8-19(9-7-17)27(24,25)22-13-10-18(11-14-22)21-12-4-5-16(2)15-21/h6-9,16,18H,3-5,10-15H2,1-2H3/p+1/t16-/m1/s1 |
| InChIKey | FTBIGRJWVATXLT-MRXNPFEDSA-O |
| XLogP | 1.33 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |