C19H25N2O4+ — CID 6594699
ethyl 4-[(3S)-3-[(3S)-3-methylpiperidin-1-ium-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 6594699) has the molecular formula C19H25N2O4+ and a molecular weight of 345.42 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[(3S)-3-methylpiperidin-1-ium-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-[(3S)-3-methylpiperidin-1-ium-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 6594699 |
| Molecular Formula | C19H25N2O4+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | ethyl 4-[(3S)-3-[(3S)-3-methylpiperidin-1-ium-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H]([NH+]3CCC[C@H](C)C3)C2=O)cc1 |
| InChI | InChI=1S/C19H24N2O4/c1-3-25-19(24)14-6-8-15(9-7-14)21-17(22)11-16(18(21)23)20-10-4-5-13(2)12-20/h6-9,13,16H,3-5,10-12H2,1-2H3/p+1/t13-,16-/m0/s1 |
| InChIKey | CMQZEGVZKDLBAA-BBRMVZONSA-O |
| XLogP | 0.81 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|