C24H25N2O4+ — CID 6988090
ethyl 4-[(3S)-2,5-dioxo-3-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)pyrrolidin-1-yl]benzoate (PubChem CID 6988090) has the molecular formula C24H25N2O4+ and a molecular weight of 405.47 g/mol. Its IUPAC name is ethyl 4-[(3S)-2,5-dioxo-3-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)pyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-2,5-dioxo-3-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 6988090 |
| Molecular Formula | C24H25N2O4+ |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | ethyl 4-[(3S)-2,5-dioxo-3-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)pyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H]([NH+]3CC=C(c4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-2-30-24(29)19-8-10-20(11-9-19)26-22(27)16-21(23(26)28)25-14-12-18(13-15-25)17-6-4-3-5-7-17/h3-12,21H,2,13-16H2,1H3/p+1/t21-/m0/s1 |
| InChIKey | UFBNNZSXPAWWBZ-NRFANRHFSA-O |
| XLogP | 1.87 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|