C21H29N2O4+ — CID 7236642
ethyl (3R)-1-[(3R)-2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]piperidin-1-ium-3-carboxylate (PubChem CID 7236642) has the molecular formula C21H29N2O4+ and a molecular weight of 373.47 g/mol. Its IUPAC name is ethyl (3R)-1-[(3R)-2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(3R)-2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 7236642 |
| Molecular Formula | C21H29N2O4+ |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | ethyl (3R)-1-[(3R)-2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+]([C@@H]2CC(=O)N(c3ccc(C(C)C)cc3)C2=O)C1 |
| InChI | InChI=1S/C21H28N2O4/c1-4-27-21(26)16-6-5-11-22(13-16)18-12-19(24)23(20(18)25)17-9-7-15(8-10-17)14(2)3/h7-10,14,16,18H,4-6,11-13H2,1-3H3/p+1/t16-,18-/m1/s1 |
| InChIKey | WJULDALUBFMPGG-SJLPKXTDSA-O |
| XLogP | 1.30 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|