C20H21N3O3 — CID 1147047
ethyl 4-[[2-(5,6-dimethylbenzimidazol-1-yl)acetyl]amino]benzoate (PubChem CID 1147047) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is ethyl 4-[[2-(5,6-dimethylbenzimidazol-1-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(5,6-dimethylbenzimidazol-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 1147047 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | ethyl 4-[[2-(5,6-dimethylbenzimidazol-1-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2cnc3cc(C)c(C)cc32)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-4-26-20(25)15-5-7-16(8-6-15)22-19(24)11-23-12-21-17-9-13(2)14(3)10-18(17)23/h5-10,12H,4,11H2,1-3H3,(H,22,24) |
| InChIKey | LDUSQOLOWBFELC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |