C21H24N4O5S — CID 53064133
ethyl 4-[3-[5-(dimethylsulfamoyl)benzimidazol-1-yl]propanoylamino]benzoate (PubChem CID 53064133) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is ethyl 4-[3-[5-(dimethylsulfamoyl)benzimidazol-1-yl]propanoylamino]benzoate.
| Compound Name | ethyl 4-[3-[5-(dimethylsulfamoyl)benzimidazol-1-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 53064133 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl 4-[3-[5-(dimethylsulfamoyl)benzimidazol-1-yl]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCn2cnc3cc(S(=O)(=O)N(C)C)ccc32)cc1 |
| InChI | InChI=1S/C21H24N4O5S/c1-4-30-21(27)15-5-7-16(8-6-15)23-20(26)11-12-25-14-22-18-13-17(9-10-19(18)25)31(28,29)24(2)3/h5-10,13-14H,4,11-12H2,1-3H3,(H,23,26) |
| InChIKey | DZELOSSAOXRCSG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |