C20H31N5O3S — CID 53064146
N-[2-(azepan-1-yl)ethyl]-3-[5-(dimethylsulfamoyl)benzimidazol-1-yl]propanamide (PubChem CID 53064146) has the molecular formula C20H31N5O3S and a molecular weight of 421.57 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-3-[5-(dimethylsulfamoyl)benzimidazol-1-yl]propanamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-3-[5-(dimethylsulfamoyl)benzimidazol-1-yl]propanamide |
|---|---|
| PubChem CID | 53064146 |
| Molecular Formula | C20H31N5O3S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-3-[5-(dimethylsulfamoyl)benzimidazol-1-yl]propanamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)ncn2CCC(=O)NCCN1CCCCCC1 |
| InChI | InChI=1S/C20H31N5O3S/c1-23(2)29(27,28)17-7-8-19-18(15-17)22-16-25(19)13-9-20(26)21-10-14-24-11-5-3-4-6-12-24/h7-8,15-16H,3-6,9-14H2,1-2H3,(H,21,26) |
| InChIKey | JMSNGNWTEARVGP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |