C22H28N4O4S — CID 53064197
3-[5-(diethylsulfamoyl)benzimidazol-1-yl]-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 53064197) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)benzimidazol-1-yl]-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)benzimidazol-1-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 53064197 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)benzimidazol-1-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)ncn2CCC(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H28N4O4S/c1-4-26(5-2)31(28,29)19-10-11-21-20(14-19)24-16-25(21)13-12-22(27)23-15-17-6-8-18(30-3)9-7-17/h6-11,14,16H,4-5,12-13,15H2,1-3H3,(H,23,27) |
| InChIKey | HZLKPBXDRUUVNM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |