C20H24FN5O3S — CID 53064559
3-[5-(diethylsulfamoyl)benzotriazol-1-yl]-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 53064559) has the molecular formula C20H24FN5O3S and a molecular weight of 433.51 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)benzotriazol-1-yl]-N-[(4-fluorophenyl)methyl]propanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)benzotriazol-1-yl]-N-[(4-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 53064559 |
| Molecular Formula | C20H24FN5O3S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)benzotriazol-1-yl]-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nnn2CCC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FN5O3S/c1-3-25(4-2)30(28,29)17-9-10-19-18(13-17)23-24-26(19)12-11-20(27)22-14-15-5-7-16(21)8-6-15/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,22,27) |
| InChIKey | KLPOKDBECSKPIN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |