C19H22FN5O3S — CID 53064527
3-[5-(diethylsulfamoyl)benzotriazol-1-yl]-N-(4-fluorophenyl)propanamide (PubChem CID 53064527) has the molecular formula C19H22FN5O3S and a molecular weight of 419.48 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)benzotriazol-1-yl]-N-(4-fluorophenyl)propanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)benzotriazol-1-yl]-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 53064527 |
| Molecular Formula | C19H22FN5O3S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)benzotriazol-1-yl]-N-(4-fluorophenyl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nnn2CCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FN5O3S/c1-3-24(4-2)29(27,28)16-9-10-18-17(13-16)22-23-25(18)12-11-19(26)21-15-7-5-14(20)6-8-15/h5-10,13H,3-4,11-12H2,1-2H3,(H,21,26) |
| InChIKey | GQCYCPXZVPSULC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |