C19H23ClN6O3S — CID 53077742
N-(5-chloro-2-pyridinyl)-4-[5-(diethylsulfamoyl)benzotriazol-1-yl]butanamide (PubChem CID 53077742) has the molecular formula C19H23ClN6O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-4-[5-(diethylsulfamoyl)benzotriazol-1-yl]butanamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-4-[5-(diethylsulfamoyl)benzotriazol-1-yl]butanamide |
|---|---|
| PubChem CID | 53077742 |
| Molecular Formula | C19H23ClN6O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-4-[5-(diethylsulfamoyl)benzotriazol-1-yl]butanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nnn2CCCC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C19H23ClN6O3S/c1-3-25(4-2)30(28,29)15-8-9-17-16(12-15)23-24-26(17)11-5-6-19(27)22-18-10-7-14(20)13-21-18/h7-10,12-13H,3-6,11H2,1-2H3,(H,21,22,27) |
| InChIKey | NWNBCULNIUEMDN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |