C21H25ClN6O5S — CID 53085096
methyl 4-chloro-2-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethylcarbamoylamino]benzoate (PubChem CID 53085096) has the molecular formula C21H25ClN6O5S and a molecular weight of 508.99 g/mol. Its IUPAC name is methyl 4-chloro-2-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethylcarbamoylamino]benzoate.
| Compound Name | methyl 4-chloro-2-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 53085096 |
| Molecular Formula | C21H25ClN6O5S |
| Molecular Weight | 508.99 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | methyl 4-chloro-2-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethylcarbamoylamino]benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nnn2CCNC(=O)Nc1cc(Cl)ccc1C(=O)OC |
| InChI | InChI=1S/C21H25ClN6O5S/c1-4-27(5-2)34(31,32)15-7-9-19-18(13-15)25-26-28(19)11-10-23-21(30)24-17-12-14(22)6-8-16(17)20(29)33-3/h6-9,12-13H,4-5,10-11H2,1-3H3,(H2,23,24,30) |
| InChIKey | IHBWSXALZSTBJL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.99 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |