C17H18ClFN6O3S — CID 53110907
1-(3-chloro-4-fluorophenyl)-3-[2-[5-(dimethylsulfamoyl)benzotriazol-1-yl]ethyl]urea (PubChem CID 53110907) has the molecular formula C17H18ClFN6O3S and a molecular weight of 440.89 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[2-[5-(dimethylsulfamoyl)benzotriazol-1-yl]ethyl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[2-[5-(dimethylsulfamoyl)benzotriazol-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 53110907 |
| Molecular Formula | C17H18ClFN6O3S |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[2-[5-(dimethylsulfamoyl)benzotriazol-1-yl]ethyl]urea |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)nnn2CCNC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClFN6O3S/c1-24(2)29(27,28)12-4-6-16-15(10-12)22-23-25(16)8-7-20-17(26)21-11-3-5-14(19)13(18)9-11/h3-6,9-10H,7-8H2,1-2H3,(H2,20,21,26) |
| InChIKey | XOHANZJJKJHUIB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |