C20H24N6O5S — CID 53085100
methyl 2-[2-[5-(dimethylsulfamoyl)benzotriazol-1-yl]ethylcarbamoylamino]-4-methylbenzoate (PubChem CID 53085100) has the molecular formula C20H24N6O5S and a molecular weight of 460.52 g/mol. Its IUPAC name is methyl 2-[2-[5-(dimethylsulfamoyl)benzotriazol-1-yl]ethylcarbamoylamino]-4-methylbenzoate.
| Compound Name | methyl 2-[2-[5-(dimethylsulfamoyl)benzotriazol-1-yl]ethylcarbamoylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 53085100 |
| Molecular Formula | C20H24N6O5S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | methyl 2-[2-[5-(dimethylsulfamoyl)benzotriazol-1-yl]ethylcarbamoylamino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)cc1NC(=O)NCCn1nnc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H24N6O5S/c1-13-5-7-15(19(27)31-4)16(11-13)22-20(28)21-9-10-26-18-8-6-14(12-17(18)23-24-26)32(29,30)25(2)3/h5-8,11-12H,9-10H2,1-4H3,(H2,21,22,28) |
| InChIKey | BGRNSXHTKKGDLN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |