C17H28N6O3S — CID 95086558
1-[(2R)-butan-2-yl]-3-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethyl]urea (PubChem CID 95086558) has the molecular formula C17H28N6O3S and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethyl]urea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 95086558 |
| Molecular Formula | C17H28N6O3S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethyl]urea |
| SMILES | CC[C@@H](C)NC(=O)NCCn1nnc2cc(S(=O)(=O)N(CC)CC)ccc21 |
| InChI | InChI=1S/C17H28N6O3S/c1-5-13(4)19-17(24)18-10-11-23-16-9-8-14(12-15(16)20-21-23)27(25,26)22(6-2)7-3/h8-9,12-13H,5-7,10-11H2,1-4H3,(H2,18,19,24)/t13-/m1/s1 |
| InChIKey | QQSJMCWPKSSZJR-CYBMUJFWSA-N |
| XLogP | 1.56 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |