C19H23BrN6O3S — CID 53110953
1-(3-bromophenyl)-3-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethyl]urea (PubChem CID 53110953) has the molecular formula C19H23BrN6O3S and a molecular weight of 495.40 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethyl]urea.
| Compound Name | 1-(3-bromophenyl)-3-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 53110953 |
| Molecular Formula | C19H23BrN6O3S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 1-(3-bromophenyl)-3-[2-[5-(diethylsulfamoyl)benzotriazol-1-yl]ethyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nnn2CCNC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C19H23BrN6O3S/c1-3-25(4-2)30(28,29)16-8-9-18-17(13-16)23-24-26(18)11-10-21-19(27)22-15-7-5-6-14(20)12-15/h5-9,12-13H,3-4,10-11H2,1-2H3,(H2,21,22,27) |
| InChIKey | LMHQKYKQDOJKAJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |