C20H24N6O2 — CID 53121059
N,N-diethyl-1-[2-(phenylcarbamoylamino)ethyl]benzotriazole-5-carboxamide (PubChem CID 53121059) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N,N-diethyl-1-[2-(phenylcarbamoylamino)ethyl]benzotriazole-5-carboxamide.
| Compound Name | N,N-diethyl-1-[2-(phenylcarbamoylamino)ethyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 53121059 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N,N-diethyl-1-[2-(phenylcarbamoylamino)ethyl]benzotriazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1)nnn2CCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H24N6O2/c1-3-25(4-2)19(27)15-10-11-18-17(14-15)23-24-26(18)13-12-21-20(28)22-16-8-6-5-7-9-16/h5-11,14H,3-4,12-13H2,1-2H3,(H2,21,22,28) |
| InChIKey | HMSFOYILSGVMAF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |