C22H26N6O3 — CID 53121165
N-cyclopentyl-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]benzotriazole-5-carboxamide (PubChem CID 53121165) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-cyclopentyl-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]benzotriazole-5-carboxamide.
| Compound Name | N-cyclopentyl-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 53121165 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-cyclopentyl-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]benzotriazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)NCCn2nnc3cc(C(=O)NC4CCCC4)ccc32)cc1 |
| InChI | InChI=1S/C22H26N6O3/c1-31-18-9-7-17(8-10-18)25-22(30)23-12-13-28-20-11-6-15(14-19(20)26-27-28)21(29)24-16-4-2-3-5-16/h6-11,14,16H,2-5,12-13H2,1H3,(H,24,29)(H2,23,25,30) |
| InChIKey | CKQNOQGOQYOETE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |