C19H21ClN6O3S — CID 53110849
1-(2-chlorophenyl)-3-[2-(5-pyrrolidin-1-ylsulfonylbenzotriazol-1-yl)ethyl]urea (PubChem CID 53110849) has the molecular formula C19H21ClN6O3S and a molecular weight of 448.94 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-(5-pyrrolidin-1-ylsulfonylbenzotriazol-1-yl)ethyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-(5-pyrrolidin-1-ylsulfonylbenzotriazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 53110849 |
| Molecular Formula | C19H21ClN6O3S |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-(5-pyrrolidin-1-ylsulfonylbenzotriazol-1-yl)ethyl]urea |
| SMILES | O=C(NCCn1nnc2cc(S(=O)(=O)N3CCCC3)ccc21)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H21ClN6O3S/c20-15-5-1-2-6-16(15)22-19(27)21-9-12-26-18-8-7-14(13-17(18)23-24-26)30(28,29)25-10-3-4-11-25/h1-2,5-8,13H,3-4,9-12H2,(H2,21,22,27) |
| InChIKey | ANNKDJLBAVVTTF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |