C21H26N6O4S — CID 53110881
1-[(3-methoxyphenyl)methyl]-3-[2-(5-pyrrolidin-1-ylsulfonylbenzotriazol-1-yl)ethyl]urea (PubChem CID 53110881) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-3-[2-(5-pyrrolidin-1-ylsulfonylbenzotriazol-1-yl)ethyl]urea.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-3-[2-(5-pyrrolidin-1-ylsulfonylbenzotriazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 53110881 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-3-[2-(5-pyrrolidin-1-ylsulfonylbenzotriazol-1-yl)ethyl]urea |
| SMILES | COc1cccc(CNC(=O)NCCn2nnc3cc(S(=O)(=O)N4CCCC4)ccc32)c1 |
| InChI | InChI=1S/C21H26N6O4S/c1-31-17-6-4-5-16(13-17)15-23-21(28)22-9-12-27-20-8-7-18(14-19(20)24-25-27)32(29,30)26-10-2-3-11-26/h4-8,13-14H,2-3,9-12,15H2,1H3,(H2,22,23,28) |
| InChIKey | FQERNZURZNJUBD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |