C19H23ClN6O3S — CID 53110987
1-(5-chloro-2-methylphenyl)-3-[2-[5-(propan-2-ylsulfamoyl)benzotriazol-1-yl]ethyl]urea (PubChem CID 53110987) has the molecular formula C19H23ClN6O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-[2-[5-(propan-2-ylsulfamoyl)benzotriazol-1-yl]ethyl]urea.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-[2-[5-(propan-2-ylsulfamoyl)benzotriazol-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 53110987 |
| Molecular Formula | C19H23ClN6O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-[2-[5-(propan-2-ylsulfamoyl)benzotriazol-1-yl]ethyl]urea |
| SMILES | Cc1ccc(Cl)cc1NC(=O)NCCn1nnc2cc(S(=O)(=O)NC(C)C)ccc21 |
| InChI | InChI=1S/C19H23ClN6O3S/c1-12(2)24-30(28,29)15-6-7-18-17(11-15)23-25-26(18)9-8-21-19(27)22-16-10-14(20)5-4-13(16)3/h4-7,10-12,24H,8-9H2,1-3H3,(H2,21,22,27) |
| InChIKey | JKCUCIDQKLPJCP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |