C21H24ClN5O3S — CID 53064385
N-[(2-chlorophenyl)methyl]-3-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)propanamide (PubChem CID 53064385) has the molecular formula C21H24ClN5O3S and a molecular weight of 461.98 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)propanamide |
|---|---|
| PubChem CID | 53064385 |
| Molecular Formula | C21H24ClN5O3S |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)propanamide |
| SMILES | O=C(CCn1nnc2cc(S(=O)(=O)N3CCCCC3)ccc21)NCc1ccccc1Cl |
| InChI | InChI=1S/C21H24ClN5O3S/c22-18-7-3-2-6-16(18)15-23-21(28)10-13-27-20-9-8-17(14-19(20)24-25-27)31(29,30)26-11-4-1-5-12-26/h2-3,6-9,14H,1,4-5,10-13,15H2,(H,23,28) |
| InChIKey | UBUVAAUWNWABGU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |