C21H23N5O3S2 — CID 53064207
N-(1,3-benzothiazol-2-yl)-3-[5-(diethylsulfamoyl)benzimidazol-1-yl]propanamide (PubChem CID 53064207) has the molecular formula C21H23N5O3S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3-[5-(diethylsulfamoyl)benzimidazol-1-yl]propanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3-[5-(diethylsulfamoyl)benzimidazol-1-yl]propanamide |
|---|---|
| PubChem CID | 53064207 |
| Molecular Formula | C21H23N5O3S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3-[5-(diethylsulfamoyl)benzimidazol-1-yl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)ncn2CCC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H23N5O3S2/c1-3-26(4-2)31(28,29)15-9-10-18-17(13-15)22-14-25(18)12-11-20(27)24-21-23-16-7-5-6-8-19(16)30-21/h5-10,13-14H,3-4,11-12H2,1-2H3,(H,23,24,27) |
| InChIKey | ZNGRKAWKISKMPR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |