C22H28N4O5S — CID 53064189
3-[5-(diethylsulfamoyl)benzimidazol-1-yl]-N-(3,5-dimethoxyphenyl)propanamide (PubChem CID 53064189) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)benzimidazol-1-yl]-N-(3,5-dimethoxyphenyl)propanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)benzimidazol-1-yl]-N-(3,5-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 53064189 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)benzimidazol-1-yl]-N-(3,5-dimethoxyphenyl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)ncn2CCC(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C22H28N4O5S/c1-5-26(6-2)32(28,29)19-7-8-21-20(14-19)23-15-25(21)10-9-22(27)24-16-11-17(30-3)13-18(12-16)31-4/h7-8,11-15H,5-6,9-10H2,1-4H3,(H,24,27) |
| InChIKey | ITTAAUVXZBNKDS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |