C23H30N4O4S — CID 40606681
3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-[(2-methoxyphenyl)methyl]propanamide (PubChem CID 40606681) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-[(2-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-[(2-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 40606681 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-[(2-methoxyphenyl)methyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(CCC(=O)NCc1ccccc1OC)n2C |
| InChI | InChI=1S/C23H30N4O4S/c1-5-27(6-2)32(29,30)18-11-12-20-19(15-18)25-22(26(20)3)13-14-23(28)24-16-17-9-7-8-10-21(17)31-4/h7-12,15H,5-6,13-14,16H2,1-4H3,(H,24,28) |
| InChIKey | QZZRHVATGIPAJD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |