C24H31FN4O3S — CID 35613656
3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-[2-(2-fluorophenyl)ethyl]propanamide (PubChem CID 35613656) has the molecular formula C24H31FN4O3S and a molecular weight of 474.60 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-[2-(2-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-[2-(2-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 35613656 |
| Molecular Formula | C24H31FN4O3S |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-[2-(2-fluorophenyl)ethyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(CCC(=O)NCCc1ccccc1F)n2CC |
| InChI | InChI=1S/C24H31FN4O3S/c1-4-28(5-2)33(31,32)19-11-12-22-21(17-19)27-23(29(22)6-3)13-14-24(30)26-16-15-18-9-7-8-10-20(18)25/h7-12,17H,4-6,13-16H2,1-3H3,(H,26,30) |
| InChIKey | AIRNULIVKXPIKE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |