C23H36N4O3S — CID 3899402
N-cycloheptyl-3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide (PubChem CID 3899402) has the molecular formula C23H36N4O3S and a molecular weight of 448.63 g/mol. Its IUPAC name is N-cycloheptyl-3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide.
| Compound Name | N-cycloheptyl-3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide |
|---|---|
| PubChem CID | 3899402 |
| Molecular Formula | C23H36N4O3S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-cycloheptyl-3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(CCC(=O)NC1CCCCCC1)n2CC |
| InChI | InChI=1S/C23H36N4O3S/c1-4-26(5-2)31(29,30)19-13-14-21-20(17-19)25-22(27(21)6-3)15-16-23(28)24-18-11-9-7-8-10-12-18/h13-14,17-18H,4-12,15-16H2,1-3H3,(H,24,28) |
| InChIKey | LUNZXDYIVQSRJF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |